CAS 1261929-01-4 appears in our catalog under these names: 4-(4-Cyanophenyl)-2-fluorobenzoic acid, 98%, 4-(4-Cyanophenyl)-2-fluorobenzoic acid, 98%, 98%, 4'-Cyano-3-fluoro-[1,1'-biphenyl]-4-carboxylic acid 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-(4-cyanophenyl)-2-fluorobenzoic acid (CAS 1261929-01-4) is a chemical compound with the molecular formula C14H8FNO2 and a molecular weight of 241.22 g/mol. IUPAC name: 4-(4-cyanophenyl)-2-fluorobenzoic acid. InChIKey: INJWSOQZWSRXQV-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO2 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 4-(4-cyanophenyl)-2-fluorobenzoic acid |
| InChIKey | INJWSOQZWSRXQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)