CAS 1345471-31-9 is the registry number for 5-(2-Cyanophenyl)-2-fluorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(2-cyanophenyl)-2-fluorobenzoic acid (CAS 1345471-31-9) is a chemical compound with the molecular formula C14H8FNO2 and a molecular weight of 241.22 g/mol. IUPAC name: 5-(2-cyanophenyl)-2-fluorobenzoic acid. InChIKey: ALXMYYDZKCKBFA-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO2 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 5-(2-cyanophenyl)-2-fluorobenzoic acid |
| InChIKey | ALXMYYDZKCKBFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC(=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)