CAS 1393441-83-2 is the registry number for 3-(4-Cyano-3-fluorophenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-cyano-3-fluorophenyl)benzoic acid (CAS 1393441-83-2) is a chemical compound with the molecular formula C14H8FNO2 and a molecular weight of 241.22 g/mol. IUPAC name: 3-(4-cyano-3-fluorophenyl)benzoic acid. InChIKey: UZYLWBSKSGNMBE-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO2 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | 3-(4-cyano-3-fluorophenyl)benzoic acid |
| InChIKey | UZYLWBSKSGNMBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)