Products 1261932-98-2
CAS 1261932-98-2 is the registry number for 6-(3-Chloro-5-fluorophenyl)picolinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
6-(3-chloro-5-fluorophenyl)pyridine-2-carboxylic acid (CAS 1261932-98-2) is a chemical compound with the molecular formula C12H7ClFNO2 and a molecular weight of 251.64 g/mol. IUPAC name: 6-(3-chloro-5-fluorophenyl)pyridine-2-carboxylic acid. InChIKey: ZGEQMAXVULGCLI-UHFFFAOYSA-N.
| Molecular formula | C12H7ClFNO2 |
|---|---|
| Molecular weight | 251.64 g/mol |
| IUPAC name | 6-(3-chloro-5-fluorophenyl)pyridine-2-carboxylic acid |
| InChIKey | ZGEQMAXVULGCLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C2=CC(=CC(=C2)Cl)F |
Computed by PubChem (NCBI)