Products 1355247-49-2
CAS 1355247-49-2 is the registry number for 2-Chloro-1-fluoro-4-(3-nitrophenyl)benzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-1-fluoro-4-(3-nitrophenyl)benzene (CAS 1355247-49-2) is a chemical compound with the molecular formula C12H7ClFNO2 and a molecular weight of 251.64 g/mol. IUPAC name: 2-chloro-1-fluoro-4-(3-nitrophenyl)benzene. InChIKey: YRLWLQFWSYVFHE-UHFFFAOYSA-N.
| Molecular formula | C12H7ClFNO2 |
|---|---|
| Molecular weight | 251.64 g/mol |
| IUPAC name | 2-chloro-1-fluoro-4-(3-nitrophenyl)benzene |
| InChIKey | YRLWLQFWSYVFHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)