Products 893740-56-2
CAS 893740-56-2 is the registry number for 5-(4-Chloro-3-fluorophenyl)nicotinic acid, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-chloro-3-fluorophenyl)pyridine-3-carboxylic acid (CAS 893740-56-2) is a chemical compound with the molecular formula C12H7ClFNO2 and a molecular weight of 251.64 g/mol. IUPAC name: 5-(4-chloro-3-fluorophenyl)pyridine-3-carboxylic acid. InChIKey: XOUVKXIFBDRANW-UHFFFAOYSA-N.
| Molecular formula | C12H7ClFNO2 |
|---|---|
| Molecular weight | 251.64 g/mol |
| IUPAC name | 5-(4-chloro-3-fluorophenyl)pyridine-3-carboxylic acid |
| InChIKey | XOUVKXIFBDRANW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CN=C2)C(=O)O)F)Cl |
Computed by PubChem (NCBI)