Products 1261946-59-1

CAS 1261946-59-1 is the registry number for 4-(4-Formylphenyl)-2-nitrobenzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(4-formylphenyl)-2-nitrobenzoic acid (CAS 1261946-59-1) is a chemical compound with the molecular formula C14H9NO5 and a molecular weight of 271.22 g/mol. IUPAC name: 4-(4-formylphenyl)-2-nitrobenzoic acid. InChIKey: LMTXRSVCAGZYBU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9NO5
Molecular weight271.22 g/mol
IUPAC name4-(4-formylphenyl)-2-nitrobenzoic acid
InChIKeyLMTXRSVCAGZYBU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=O)C2=CC(=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)