CAS 356575-75-2 appears in our catalog under these names: 2-(2-Furylmethyl)-1,3-dioxoisoindoline-5-carboxylic acid, 2-(2-Furylmethyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g.
2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 356575-75-2) is a chemical compound with the molecular formula C14H9NO5 and a molecular weight of 271.22 g/mol. IUPAC name: 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: VALJDQQNBSEPEW-UHFFFAOYSA-N.
| Molecular formula | C14H9NO5 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | 2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | VALJDQQNBSEPEW-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)