Products 7377-13-1
CAS 7377-13-1 appears in our catalog under these names: 4-(4-Nitrobenzoyl)benzoic acid, 95%, 4-(4-Nitrobenzoyl)benzoic acid 96%, 4-(4-Nitrobenzoyl)benzoic acid, 96%, 96%, 4-(4-Nitrobenzoyl)benzoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
4-(4-nitrobenzoyl)benzoic acid (CAS 7377-13-1) is a chemical compound with the molecular formula C14H9NO5 and a molecular weight of 271.22 g/mol. IUPAC name: 4-(4-nitrobenzoyl)benzoic acid. InChIKey: FGGHZEMNYJKTDV-UHFFFAOYSA-N.
| Molecular formula | C14H9NO5 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | 4-(4-nitrobenzoyl)benzoic acid |
| InChIKey | FGGHZEMNYJKTDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)