CAS 1261948-09-7 appears in our catalog under these names: 4-(3-Formylphenyl)-2-methylphenol, 95%, 4'-Hydroxy-3'-methyl-(1,1'-biphenyl)-3-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4-hydroxy-3-methylphenyl)benzaldehyde (CAS 1261948-09-7) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 3-(4-hydroxy-3-methylphenyl)benzaldehyde. InChIKey: IPZYCXWUWRCUCX-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 3-(4-hydroxy-3-methylphenyl)benzaldehyde |
| InChIKey | IPZYCXWUWRCUCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC(=C2)C=O)O |
Computed by PubChem (NCBI)