Products 1261950-40-6
CAS 1261950-40-6 appears in our catalog under these names: 4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3,5-dicarboxylic acid, 95%, 95%, 4'-Formyl-3'-hydroxy[1,1'-biphenyl]-3,5-dicarboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(4-formyl-3-hydroxyphenyl)benzene-1,3-dicarboxylic acid (CAS 1261950-40-6) is a chemical compound with the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. IUPAC name: 5-(4-formyl-3-hydroxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: XPDARTILVKCDIY-UHFFFAOYSA-N.
| Molecular formula | C15H10O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 5-(4-formyl-3-hydroxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | XPDARTILVKCDIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)O)C=O |
Computed by PubChem (NCBI)