Products 1261960-95-5
CAS 1261960-95-5 appears in our catalog under these names: 3-Chloro-5-(2,3-difluorophenyl)phenol, 95%, 5-Chloro-2',3'-difluoro-(1,1'-biphenyl)-3-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-chloro-5-(2,3-difluorophenyl)phenol (CAS 1261960-95-5) is a chemical compound with the molecular formula C12H7ClF2O and a molecular weight of 240.63 g/mol. IUPAC name: 3-chloro-5-(2,3-difluorophenyl)phenol. InChIKey: UHIYLWJCTQOCBG-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF2O |
|---|---|
| Molecular weight | 240.63 g/mol |
| IUPAC name | 3-chloro-5-(2,3-difluorophenyl)phenol |
| InChIKey | UHIYLWJCTQOCBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C2=CC(=CC(=C2)Cl)O |
Computed by PubChem (NCBI)