Products 141110-96-5
CAS 141110-96-5 is the registry number for 2-chloro-2,2-difluoro-1-(naphthalen-2-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-2,2-difluoro-1-naphthalen-2-ylethanone (CAS 141110-96-5) is a chemical compound with the molecular formula C12H7ClF2O and a molecular weight of 240.63 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-naphthalen-2-ylethanone. InChIKey: JMMRIMKVQGRGGO-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF2O |
|---|---|
| Molecular weight | 240.63 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-naphthalen-2-ylethanone |
| InChIKey | JMMRIMKVQGRGGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)