CAS 1262002-54-9 is the registry number for 3-Chloro-5-(2,4-difluorophenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-chloro-5-(2,4-difluorophenyl)phenol (CAS 1262002-54-9) is a chemical compound with the molecular formula C12H7ClF2O and a molecular weight of 240.63 g/mol. IUPAC name: 3-chloro-5-(2,4-difluorophenyl)phenol. InChIKey: ZHRZAGROKDMNIZ-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF2O |
|---|---|
| Molecular weight | 240.63 g/mol |
| IUPAC name | 3-chloro-5-(2,4-difluorophenyl)phenol |
| InChIKey | ZHRZAGROKDMNIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=CC(=CC(=C2)Cl)O |
Computed by PubChem (NCBI)