CAS 1261971-09-8 appears in our catalog under these names: 3-(2,4-Dimethylphenyl)-2-methylbenzoic acid, 98%, 2,2',4'-Trimethyl-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(2,4-dimethylphenyl)-2-methylbenzoic acid (CAS 1261971-09-8) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 3-(2,4-dimethylphenyl)-2-methylbenzoic acid. InChIKey: NBESNFBLRRAOJS-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 3-(2,4-dimethylphenyl)-2-methylbenzoic acid |
| InChIKey | NBESNFBLRRAOJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=C(C(=CC=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)