CAS 1261971-14-5 is the registry number for 4-(3,5-Dimethylphenyl)-3-methylbenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3,5-dimethylphenyl)-3-methylbenzoic acid (CAS 1261971-14-5) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)-3-methylbenzoic acid. InChIKey: VVOZWOSSANZQEE-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)-3-methylbenzoic acid |
| InChIKey | VVOZWOSSANZQEE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=C(C=C(C=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)