CAS 1261972-63-7 is the registry number for 2-Chloro-5-(4-chloro-2-methoxyphenyl)phenol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-chloro-5-(4-chloro-2-methoxyphenyl)phenol (CAS 1261972-63-7) is a chemical compound with the molecular formula C13H10Cl2O2 and a molecular weight of 269.12 g/mol. IUPAC name: 2-chloro-5-(4-chloro-2-methoxyphenyl)phenol. InChIKey: QHTSGKBACNDLJR-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O2 |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 2-chloro-5-(4-chloro-2-methoxyphenyl)phenol |
| InChIKey | QHTSGKBACNDLJR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC(=C(C=C2)Cl)O |
Computed by PubChem (NCBI)