CAS 4640-07-7 is the registry number for 4,4'–Dichlor–2–methoxydiphenyl–aether. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-chloro-1-(4-chlorophenoxy)-2-methoxybenzene (CAS 4640-07-7) is a chemical compound with the molecular formula C13H10Cl2O2 and a molecular weight of 269.12 g/mol. IUPAC name: 4-chloro-1-(4-chlorophenoxy)-2-methoxybenzene. InChIKey: ZYGFCBHGKUSHCO-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2O2 |
|---|---|
| Molecular weight | 269.12 g/mol |
| IUPAC name | 4-chloro-1-(4-chlorophenoxy)-2-methoxybenzene |
| InChIKey | ZYGFCBHGKUSHCO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)