CAS 1261975-35-2 is the registry number for 4'-Chloro-2'-methoxy-(1,1'-biphenyl)-3-ol. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-chloro-2-methoxyphenyl)phenol (CAS 1261975-35-2) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 3-(4-chloro-2-methoxyphenyl)phenol. InChIKey: KYQYEUDVCVQGTC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-(4-chloro-2-methoxyphenyl)phenol |
| InChIKey | KYQYEUDVCVQGTC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)