CAS 1261978-33-9 is the registry number for 5-(4-Chloro-2-methylphenyl)-3-pyridinecarboxylic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-(4-chloro-2-methylphenyl)pyridine-3-carboxylic acid (CAS 1261978-33-9) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: 5-(4-chloro-2-methylphenyl)pyridine-3-carboxylic acid. InChIKey: DIBSBYCWJDMCNV-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 5-(4-chloro-2-methylphenyl)pyridine-3-carboxylic acid |
| InChIKey | DIBSBYCWJDMCNV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)