CAS 1261999-46-5 appears in our catalog under these names: 4-(3-Chloro-4-methoxycarbonylphenyl)-2-fluorophenol, 98%, Methyl 3-chloro-3'-fluoro-4'-hydroxy-(1,1'-biphenyl)-4-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 2-chloro-4-(3-fluoro-4-hydroxyphenyl)benzoate (CAS 1261999-46-5) is a chemical compound with the molecular formula C14H10ClFO3 and a molecular weight of 280.68 g/mol. IUPAC name: methyl 2-chloro-4-(3-fluoro-4-hydroxyphenyl)benzoate. InChIKey: GYJKDFMONVCQLQ-UHFFFAOYSA-N.
| Molecular formula | C14H10ClFO3 |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | methyl 2-chloro-4-(3-fluoro-4-hydroxyphenyl)benzoate |
| InChIKey | GYJKDFMONVCQLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=C(C=C2)O)F)Cl |
Computed by PubChem (NCBI)