Products 2807466-88-0

CAS 2807466-88-0 is the registry number for 3-(Benzyloxy)-5-chloro-4-fluorobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-chloro-4-fluoro-5-phenylmethoxybenzoic acid (CAS 2807466-88-0) is a chemical compound with the molecular formula C14H10ClFO3 and a molecular weight of 280.68 g/mol. IUPAC name: 3-chloro-4-fluoro-5-phenylmethoxybenzoic acid. InChIKey: IXEYORCBLMLXJP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10ClFO3
Molecular weight280.68 g/mol
IUPAC name3-chloro-4-fluoro-5-phenylmethoxybenzoic acid
InChIKeyIXEYORCBLMLXJP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C(=CC(=C2)C(=O)O)Cl)F

Computed by PubChem (NCBI)