Products 2384919-02-0

CAS 2384919-02-0 is the registry number for 4-(Benzyloxy)-5-chloro-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-chloro-2-fluoro-4-phenylmethoxybenzoic acid (CAS 2384919-02-0) is a chemical compound with the molecular formula C14H10ClFO3 and a molecular weight of 280.68 g/mol. IUPAC name: 5-chloro-2-fluoro-4-phenylmethoxybenzoic acid. InChIKey: CHDSKGPMBVKWFE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10ClFO3
Molecular weight280.68 g/mol
IUPAC name5-chloro-2-fluoro-4-phenylmethoxybenzoic acid
InChIKeyCHDSKGPMBVKWFE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=C(C(=C2)F)C(=O)O)Cl

Computed by PubChem (NCBI)