CAS 1262000-17-8 is the registry number for 4-(2-N,N-Dimethylsulfamoylphenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-hydroxyphenyl)-N,N-dimethylbenzenesulfonamide (CAS 1262000-17-8) is a chemical compound with the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-N,N-dimethylbenzenesulfonamide. InChIKey: DCGCQNHCPAXPHE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | DCGCQNHCPAXPHE-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)