Products 691393-97-2
CAS 691393-97-2 appears in our catalog under these names: 3-Amino-5-(4-ethoxyphenyl)thiophene-2-carboxylic acid methyl ester, 95%, 3–Amino–5–(4–ethoxyphenyl)thiophene–2–carboxylic acid methyl ester. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-amino-5-(4-ethoxyphenyl)thiophene-2-carboxylate (CAS 691393-97-2) is a chemical compound with the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. IUPAC name: methyl 3-amino-5-(4-ethoxyphenyl)thiophene-2-carboxylate. InChIKey: KOGXJKJPBBNEFK-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | methyl 3-amino-5-(4-ethoxyphenyl)thiophene-2-carboxylate |
| InChIKey | KOGXJKJPBBNEFK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=CC(=C(S2)C(=O)OC)N |
Computed by PubChem (NCBI)