Products 152171-06-7
CAS 152171-06-7 is the registry number for 3-Propanoyl-1-tosylpyrrole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
1-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]propan-1-one (CAS 152171-06-7) is a chemical compound with the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. IUPAC name: 1-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]propan-1-one. InChIKey: RPYUZPGNZSVCGG-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3S |
|---|---|
| Molecular weight | 277.34 g/mol |
| IUPAC name | 1-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]propan-1-one |
| InChIKey | RPYUZPGNZSVCGG-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CN(C=C1)S(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)