Products 1262010-73-0

CAS 1262010-73-0 is the registry number for 2'-Methyl-[1,1'-biphenyl]-3,4',5-tricarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(4-carboxy-2-methylphenyl)benzene-1,3-dicarboxylic acid (CAS 1262010-73-0) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 5-(4-carboxy-2-methylphenyl)benzene-1,3-dicarboxylic acid. InChIKey: CQFBRKKUYTZJCF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O6
Molecular weight300.26 g/mol
IUPAC name5-(4-carboxy-2-methylphenyl)benzene-1,3-dicarboxylic acid
InChIKeyCQFBRKKUYTZJCF-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(=O)O)C2=CC(=CC(=C2)C(=O)O)C(=O)O

Computed by PubChem (NCBI)