CAS 4720-82-5 appears in our catalog under these names: Piperoin, 95%, Piperoin. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 10g, 5g.
1,2-bis(1,3-benzodioxol-5-yl)-2-hydroxyethanone (CAS 4720-82-5) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 1,2-bis(1,3-benzodioxol-5-yl)-2-hydroxyethanone. InChIKey: BNSRFLSWNIACBZ-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 1,2-bis(1,3-benzodioxol-5-yl)-2-hydroxyethanone |
| InChIKey | BNSRFLSWNIACBZ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(C(=O)C3=CC4=C(C=C3)OCO4)O |
Computed by PubChem (NCBI)