Products 1189728-54-8
CAS 1189728-54-8 appears in our catalog under these names: Diosmetin-d3, Diosmetin–d3. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 500 μg.
5,7-dihydroxy-2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]chromen-4-one (CAS 1189728-54-8) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 303.28 g/mol. IUPAC name: 5,7-dihydroxy-2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]chromen-4-one. InChIKey: MBNGWHIJMBWFHU-FIBGUPNXSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 303.28 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[3-hydroxy-4-(trideuteriomethoxy)phenyl]chromen-4-one |
| InChIKey | MBNGWHIJMBWFHU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)