Products 1262406-78-9
CAS 1262406-78-9 is the registry number for tert-butyl 7-formyl-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 7-formyl-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate (CAS 1262406-78-9) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: tert-butyl 7-formyl-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate. InChIKey: VBUUOFADPFDMQT-UHFFFAOYSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | tert-butyl 7-formyl-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate |
| InChIKey | VBUUOFADPFDMQT-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C2=C1C=CC(=C2)C=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)