Products 1262407-55-5
CAS 1262407-55-5 is the registry number for 1,4-Dioxaspiro(4.5)decane-8-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,4-dioxaspiro[4.5]decane-8-sulfonyl chloride (CAS 1262407-55-5) is a chemical compound with the molecular formula C8H13ClO4S and a molecular weight of 240.71 g/mol. IUPAC name: 1,4-dioxaspiro[4.5]decane-8-sulfonyl chloride. InChIKey: UJVGMYFOZBPBCH-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO4S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 1,4-dioxaspiro[4.5]decane-8-sulfonyl chloride |
| InChIKey | UJVGMYFOZBPBCH-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1S(=O)(=O)Cl)OCCO2 |
Computed by PubChem (NCBI)