CAS 2241131-30-4 is the registry number for (1,7-Dioxaspiro(4.4)nonan-2-yl)methanesulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1,7-dioxaspiro[4.4]nonan-2-ylmethanesulfonyl chloride (CAS 2241131-30-4) is a chemical compound with the molecular formula C8H13ClO4S and a molecular weight of 240.71 g/mol. IUPAC name: 1,7-dioxaspiro[4.4]nonan-2-ylmethanesulfonyl chloride. InChIKey: FAYNJSRRUFZHPP-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO4S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 1,7-dioxaspiro[4.4]nonan-2-ylmethanesulfonyl chloride |
| InChIKey | FAYNJSRRUFZHPP-UHFFFAOYSA-N |
| SMILES | C1CC2(CCOC2)OC1CS(=O)(=O)Cl |
Computed by PubChem (NCBI)