Products 1803570-67-3
CAS 1803570-67-3 is the registry number for Methyl 1-((chlorosulfonyl)methyl)cyclopentane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 1-(chlorosulfonylmethyl)cyclopentane-1-carboxylate (CAS 1803570-67-3) is a chemical compound with the molecular formula C8H13ClO4S and a molecular weight of 240.71 g/mol. IUPAC name: methyl 1-(chlorosulfonylmethyl)cyclopentane-1-carboxylate. InChIKey: BFSSPRSEXYILLT-UHFFFAOYSA-N.
| Molecular formula | C8H13ClO4S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | methyl 1-(chlorosulfonylmethyl)cyclopentane-1-carboxylate |
| InChIKey | BFSSPRSEXYILLT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCCC1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)