Products 1262408-00-3
CAS 1262408-00-3 is the registry number for 3,4-Dichloro-1H-pyrazolo(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,4-dichloro-2H-pyrazolo[3,4-d]pyrimidine (CAS 1262408-00-3) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 3,4-dichloro-2H-pyrazolo[3,4-d]pyrimidine. InChIKey: JRCNRZSBSWQTRJ-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 3,4-dichloro-2H-pyrazolo[3,4-d]pyrimidine |
| InChIKey | JRCNRZSBSWQTRJ-UHFFFAOYSA-N |
| SMILES | C1=NC2=NNC(=C2C(=N1)Cl)Cl |
Computed by PubChem (NCBI)