CAS 2044706-29-6 appears in our catalog under these names: (5S)-5-{((propan-2-yl)amino)methyl}pyrrolidin-2-one hydrochloride, 95%, (5S)-5-{((Propan-2-yl)amino)methyl}pyrrolidin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(5S)-5-[(propan-2-ylamino)methyl]pyrrolidin-2-one;hydrochloride (CAS 2044706-29-6) is a chemical compound with the molecular formula C8H17ClN2O and a molecular weight of 192.68 g/mol. IUPAC name: (5S)-5-[(propan-2-ylamino)methyl]pyrrolidin-2-one;hydrochloride. InChIKey: UZLLPQJPBDVCCQ-FJXQXJEOSA-N.
| Molecular formula | C8H17ClN2O |
|---|---|
| Molecular weight | 192.68 g/mol |
| IUPAC name | (5S)-5-[(propan-2-ylamino)methyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | UZLLPQJPBDVCCQ-FJXQXJEOSA-N |
| SMILES | CC(C)NC[C@@H]1CCC(=O)N1.Cl |
Computed by PubChem (NCBI)