CAS 1262794-26-2 is the registry number for (2S,3S)-1,4-Bis(2-bromophenyl)butane-2,3-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-1,4-bis(2-bromophenyl)butane-2,3-diamine (CAS 1262794-26-2) is a chemical compound with the molecular formula C16H18Br2N2 and a molecular weight of 398.13 g/mol. IUPAC name: (2S,3S)-1,4-bis(2-bromophenyl)butane-2,3-diamine. InChIKey: RHQAQXXGXACRMF-HOTGVXAUSA-N.
| Molecular formula | C16H18Br2N2 |
|---|---|
| Molecular weight | 398.13 g/mol |
| IUPAC name | (2S,3S)-1,4-bis(2-bromophenyl)butane-2,3-diamine |
| InChIKey | RHQAQXXGXACRMF-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H]([C@H](CC2=CC=CC=C2Br)N)N)Br |
Computed by PubChem (NCBI)