CAS 2444430-75-3 is the registry number for (1R,2R)-1,2-Bis(2-bromophenyl)-N1,N2-dimethylethane-1,2-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R)-1,2-bis(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine (CAS 2444430-75-3) is a chemical compound with the molecular formula C16H18Br2N2 and a molecular weight of 398.13 g/mol. IUPAC name: (1R,2R)-1,2-bis(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine. InChIKey: GHAWUBLBTKRGGP-HZPDHXFCSA-N.
| Molecular formula | C16H18Br2N2 |
|---|---|
| Molecular weight | 398.13 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(2-bromophenyl)-N,N'-dimethylethane-1,2-diamine |
| InChIKey | GHAWUBLBTKRGGP-HZPDHXFCSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1Br)[C@@H](C2=CC=CC=C2Br)NC |
Computed by PubChem (NCBI)