CAS 479496-39-4 appears in our catalog under these names: (1S,2S)-1,2-Bis(4-bromophenyl)-N1,N2-dimethylethane-1,2-diamine, 97%, (1S,2S)–1,2–bis(4–bromophenyl)–N1,N2–dimethylethane–1,2–diamine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 1g, 25mg, 500mg.
(1S,2S)-1,2-bis(4-bromophenyl)-N,N'-dimethylethane-1,2-diamine (CAS 479496-39-4) is a chemical compound with the molecular formula C16H18Br2N2 and a molecular weight of 398.13 g/mol. IUPAC name: (1S,2S)-1,2-bis(4-bromophenyl)-N,N'-dimethylethane-1,2-diamine. InChIKey: WVRUGMYZGAOFJU-HOTGVXAUSA-N.
| Molecular formula | C16H18Br2N2 |
|---|---|
| Molecular weight | 398.13 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(4-bromophenyl)-N,N'-dimethylethane-1,2-diamine |
| InChIKey | WVRUGMYZGAOFJU-HOTGVXAUSA-N |
| SMILES | CN[C@@H](C1=CC=C(C=C1)Br)[C@H](C2=CC=C(C=C2)Br)NC |
Computed by PubChem (NCBI)