Products 1262983-79-8

CAS 1262983-79-8 is the registry number for 2-(Morpholin-4-ylmethyl)aniline sulfate hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(morpholin-4-ylmethyl)aniline;sulfuric acid;hydrate (CAS 1262983-79-8) is a chemical compound with the molecular formula C11H20N2O6S and a molecular weight of 308.35 g/mol. IUPAC name: 2-(morpholin-4-ylmethyl)aniline;sulfuric acid;hydrate. InChIKey: UAPDBLWAYLKUGE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20N2O6S
Molecular weight308.35 g/mol
IUPAC name2-(morpholin-4-ylmethyl)aniline;sulfuric acid;hydrate
InChIKeyUAPDBLWAYLKUGE-UHFFFAOYSA-N
SMILESC1COCCN1CC2=CC=CC=C2N.O.OS(=O)(=O)O

Computed by PubChem (NCBI)