CAS 75893-04-8 is the registry number for Boc-L-Cys(Acm,O)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.
(2R)-3-(acetamidomethylsulfinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 75893-04-8) is a chemical compound with the molecular formula C11H20N2O6S and a molecular weight of 308.35 g/mol. IUPAC name: (2R)-3-(acetamidomethylsulfinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RNEUQBJGDKCBAI-RQJNJCINSA-N.
| Molecular formula | C11H20N2O6S |
|---|---|
| Molecular weight | 308.35 g/mol |
| IUPAC name | (2R)-3-(acetamidomethylsulfinyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RNEUQBJGDKCBAI-RQJNJCINSA-N |
| SMILES | CC(=O)NCS(=O)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)