CAS 939997-64-5 appears in our catalog under these names: 4-Methanesulfonyl-piperazine-1,2-dicarboxylic acid 1-tert-butyl ester, 96%, 1-(tert-Butoxycarbonyl)-4-(methylsulfonyl)piperazine-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylpiperazine-2-carboxylic acid (CAS 939997-64-5) is a chemical compound with the molecular formula C11H20N2O6S and a molecular weight of 308.35 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylpiperazine-2-carboxylic acid. InChIKey: SJUXSKMCWBAOPN-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O6S |
|---|---|
| Molecular weight | 308.35 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonylpiperazine-2-carboxylic acid |
| InChIKey | SJUXSKMCWBAOPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)