CAS 1263213-93-9 is the registry number for 3-Iodo-6-(1-methylethyl)-1H-indole-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 1g.
3-iodo-6-propan-2-yl-1H-indole-2-carboxylic acid (CAS 1263213-93-9) is a chemical compound with the molecular formula C12H12INO2 and a molecular weight of 329.13 g/mol. IUPAC name: 3-iodo-6-propan-2-yl-1H-indole-2-carboxylic acid. InChIKey: OOBZFVQRYKEWDY-UHFFFAOYSA-N.
| Molecular formula | C12H12INO2 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | 3-iodo-6-propan-2-yl-1H-indole-2-carboxylic acid |
| InChIKey | OOBZFVQRYKEWDY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)C(=C(N2)C(=O)O)I |
Computed by PubChem (NCBI)