CAS 168080-93-1 is the registry number for 2,2,3,3,9,9,10,10-Octamethyl-6-(2-propen-1-yl)-4,8-dioxa-3,9-disilaundecane. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(1-methylquinolin-1-ium-7-yl) acetate iodide (CAS 168080-93-1) is a chemical compound with the molecular formula C12H12INO2 and a molecular weight of 329.13 g/mol. IUPAC name: (1-methylquinolin-1-ium-7-yl) acetate iodide. InChIKey: IFUAVRXVEJBLFI-UHFFFAOYSA-M.
| Molecular formula | C12H12INO2 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | (1-methylquinolin-1-ium-7-yl) acetate iodide |
| InChIKey | IFUAVRXVEJBLFI-UHFFFAOYSA-M |
| SMILES | CC(=O)OC1=CC2=C(C=CC=[N+]2C)C=C1.[I-] |
Computed by PubChem (NCBI)