Products 1263284-28-1
CAS 1263284-28-1 is the registry number for 1-Pyridin-2-yl-4,6-dihydro-1h-pyrrolo[3,4-c]pyrazole-5-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 1-pyridin-2-yl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1263284-28-1) is a chemical compound with the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. IUPAC name: tert-butyl 1-pyridin-2-yl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: WOAXJYBTIXPXSJ-UHFFFAOYSA-N.
| Molecular formula | C15H18N4O2 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | tert-butyl 1-pyridin-2-yl-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | WOAXJYBTIXPXSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N(N=C2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)