CAS 571189-64-5 appears in our catalog under these names: Palbociclib Impurity 79, Palbociclib Impurity 47, Palbociclib Impurity 117, 6-Acetyl-2-amino-8-cyclopentyl-5-methyl-8H-pyrido(2,3-d)pyrimidin-7-one. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-acetyl-2-amino-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (CAS 571189-64-5) is a chemical compound with the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. IUPAC name: 6-acetyl-2-amino-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one. InChIKey: LXKNTYGIJJDNJG-UHFFFAOYSA-N.
| Molecular formula | C15H18N4O2 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | 6-acetyl-2-amino-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | LXKNTYGIJJDNJG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)N)C3CCCC3)C(=O)C |
Computed by PubChem (NCBI)