CAS 1914100-66-5 is the registry number for Benzyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1914100-66-5) is a chemical compound with the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. IUPAC name: benzyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: YJKRLAWECNNSCD-UHFFFAOYSA-N.
| Molecular formula | C15H18N4O2 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | benzyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | YJKRLAWECNNSCD-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CN1C(=O)OCC3=CC=CC=C3)C(=NN2)N)C |
Computed by PubChem (NCBI)