Products 1263285-70-6
CAS 1263285-70-6 is the registry number for 1-(Bromomethyl)-3-trifluoromethanesulfinylbenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(bromomethyl)-3-(trifluoromethylsulfinyl)benzene (CAS 1263285-70-6) is a chemical compound with the molecular formula C8H6BrF3OS and a molecular weight of 287.10 g/mol. IUPAC name: 1-(bromomethyl)-3-(trifluoromethylsulfinyl)benzene. InChIKey: CYMXAAKDJZATDK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3OS |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(trifluoromethylsulfinyl)benzene |
| InChIKey | CYMXAAKDJZATDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)C(F)(F)F)CBr |
Computed by PubChem (NCBI)