Products 1808089-06-6
CAS 1808089-06-6 is the registry number for 3-Bromo-1-methoxy-4-((trifluoromethyl)thio)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
2-bromo-4-methoxy-1-(trifluoromethylsulfanyl)benzene (CAS 1808089-06-6) is a chemical compound with the molecular formula C8H6BrF3OS and a molecular weight of 287.10 g/mol. IUPAC name: 2-bromo-4-methoxy-1-(trifluoromethylsulfanyl)benzene. InChIKey: RNYQOWNODNFRRP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3OS |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | 2-bromo-4-methoxy-1-(trifluoromethylsulfanyl)benzene |
| InChIKey | RNYQOWNODNFRRP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)SC(F)(F)F)Br |
Computed by PubChem (NCBI)