Products 2167312-00-5
CAS 2167312-00-5 is the registry number for (3-Bromo-5-(trifluoromethoxy)phenyl)(methyl)sulfane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-3-methylsulfanyl-5-(trifluoromethoxy)benzene (CAS 2167312-00-5) is a chemical compound with the molecular formula C8H6BrF3OS and a molecular weight of 287.10 g/mol. IUPAC name: 1-bromo-3-methylsulfanyl-5-(trifluoromethoxy)benzene. InChIKey: PERYEEDVHXPNOQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3OS |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | 1-bromo-3-methylsulfanyl-5-(trifluoromethoxy)benzene |
| InChIKey | PERYEEDVHXPNOQ-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)