Products 1263375-23-0

CAS 1263375-23-0 appears in our catalog under these names: 2,5-Difluoropyridine-4-boronic acid, 96%, (2,5-Difluoropyridin-4-yl)boronic acid 97%, (2,5-Difluoropyridin-4-yl)boronic acid, 97%, 97%, 2,5-DIFLUOROPYRIDIN-4-YLBORONIC ACID, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(2,5-difluoro-4-pyridinyl)boronic acid (CAS 1263375-23-0) is a chemical compound with the molecular formula C5H4BF2NO2 and a molecular weight of 158.90 g/mol. IUPAC name: (2,5-difluoro-4-pyridinyl)boronic acid. InChIKey: CFUGAJDUGLGADA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BF2NO2
Molecular weight158.90 g/mol
IUPAC name(2,5-difluoro-4-pyridinyl)boronic acid
InChIKeyCFUGAJDUGLGADA-UHFFFAOYSA-N
SMILESB(C1=CC(=NC=C1F)F)(O)O

Computed by PubChem (NCBI)